C23H25N3O4 — CID 4151736
N-(3-ethoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-4-phenylbenzamide (PubChem CID 4151736) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-4-phenylbenzamide.
| Compound Name | N-(3-ethoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 4151736 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-(3-ethoxypropyl)-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-4-phenylbenzamide |
| SMILES | CCOCCCN(CC(=O)Nc1ccon1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-2-29-15-6-14-26(17-22(27)24-21-13-16-30-25-21)23(28)20-11-9-19(10-12-20)18-7-4-3-5-8-18/h3-5,7-13,16H,2,6,14-15,17H2,1H3,(H,24,25,27) |
| InChIKey | ZBFVGENRVQHIBZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|