C19H26N4O4 — CID 42771761
2-[(3,4-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 42771761) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]-N-(1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[(3,4-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]-N-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 42771761 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | CCOCCCN(CC(=O)Nc1ccon1)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H26N4O4/c1-4-26-10-5-9-23(13-18(24)21-17-8-11-27-22-17)19(25)20-16-7-6-14(2)15(3)12-16/h6-8,11-12H,4-5,9-10,13H2,1-3H3,(H,20,25)(H,21,22,24) |
| InChIKey | AYKNERGEQNIFCM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|