C19H23F3N4O4 — CID 3637081
2-[3-ethoxypropyl-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 3637081) has the molecular formula C19H23F3N4O4 and a molecular weight of 428.41 g/mol. Its IUPAC name is 2-[3-ethoxypropyl-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[3-ethoxypropyl-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 3637081 |
| Molecular Formula | C19H23F3N4O4 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[3-ethoxypropyl-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CCOCCCN(CC(=O)Nc1cc(C)on1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H23F3N4O4/c1-3-29-9-5-8-26(12-17(27)24-16-10-13(2)30-25-16)18(28)23-15-7-4-6-14(11-15)19(20,21)22/h4,6-7,10-11H,3,5,8-9,12H2,1-2H3,(H,23,28)(H,24,25,27) |
| InChIKey | SLKHPHSSFIHBKR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|