C18H22Cl2N4O4 — CID 5101637
2-[(2,3-dichlorophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 5101637) has the molecular formula C18H22Cl2N4O4 and a molecular weight of 429.30 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[(2,3-dichlorophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 5101637 |
| Molecular Formula | C18H22Cl2N4O4 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)carbamoyl-(3-ethoxypropyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CCOCCCN(CC(=O)Nc1cc(C)on1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H22Cl2N4O4/c1-3-27-9-5-8-24(11-16(25)22-15-10-12(2)28-23-15)18(26)21-14-7-4-6-13(19)17(14)20/h4,6-7,10H,3,5,8-9,11H2,1-2H3,(H,21,26)(H,22,23,25) |
| InChIKey | HXBGZHMWAMXJCU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|