C15H24N4O6 — CID 3475616
ethyl 2-[[3-methoxypropyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]carbamoyl]amino]acetate (PubChem CID 3475616) has the molecular formula C15H24N4O6 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl 2-[[3-methoxypropyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]carbamoyl]amino]acetate.
| Compound Name | ethyl 2-[[3-methoxypropyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]carbamoyl]amino]acetate |
|---|---|
| PubChem CID | 3475616 |
| Molecular Formula | C15H24N4O6 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | ethyl 2-[[3-methoxypropyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]carbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(CCCOC)CC(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C15H24N4O6/c1-4-24-14(21)9-16-15(22)19(6-5-7-23-3)10-13(20)17-12-8-11(2)25-18-12/h8H,4-7,9-10H2,1-3H3,(H,16,22)(H,17,18,20) |
| InChIKey | KYVDKISLKNQBEZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|