C14H25N3O5S — CID 3307348
2-[butylsulfonyl(3-methoxypropyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 3307348) has the molecular formula C14H25N3O5S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[butylsulfonyl(3-methoxypropyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[butylsulfonyl(3-methoxypropyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 3307348 |
| Molecular Formula | C14H25N3O5S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[butylsulfonyl(3-methoxypropyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CCCCS(=O)(=O)N(CCCOC)CC(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C14H25N3O5S/c1-4-5-9-23(19,20)17(7-6-8-21-3)11-14(18)15-13-10-12(2)22-16-13/h10H,4-9,11H2,1-3H3,(H,15,16,18) |
| InChIKey | DUUUSQNQHCMWDT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|