C14H25N3O4S — CID 42664185
2-[butylsulfonyl(pentyl)amino]-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 42664185) has the molecular formula C14H25N3O4S and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-[butylsulfonyl(pentyl)amino]-N-(1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[butylsulfonyl(pentyl)amino]-N-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 42664185 |
| Molecular Formula | C14H25N3O4S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-[butylsulfonyl(pentyl)amino]-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | CCCCCN(CC(=O)Nc1ccon1)S(=O)(=O)CCCC |
| InChI | InChI=1S/C14H25N3O4S/c1-3-5-7-9-17(22(19,20)11-6-4-2)12-14(18)15-13-8-10-21-16-13/h8,10H,3-7,9,11-12H2,1-2H3,(H,15,16,18) |
| InChIKey | NFFAFYZPCYMYAU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|