C16H27N3O3 — CID 42769111
N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-propan-2-yloctanamide (PubChem CID 42769111) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-propan-2-yloctanamide.
| Compound Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-propan-2-yloctanamide |
|---|---|
| PubChem CID | 42769111 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-propan-2-yloctanamide |
| SMILES | CCCCCCCC(=O)N(CC(=O)Nc1ccon1)C(C)C |
| InChI | InChI=1S/C16H27N3O3/c1-4-5-6-7-8-9-16(21)19(13(2)3)12-15(20)17-14-10-11-22-18-14/h10-11,13H,4-9,12H2,1-3H3,(H,17,18,20) |
| InChIKey | HLGJULRTHKKPPT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|