C20H23N3O4S — CID 42769416
2-[naphthalen-2-ylsulfonyl(pentyl)amino]-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 42769416) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-[naphthalen-2-ylsulfonyl(pentyl)amino]-N-(1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[naphthalen-2-ylsulfonyl(pentyl)amino]-N-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 42769416 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-[naphthalen-2-ylsulfonyl(pentyl)amino]-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | CCCCCN(CC(=O)Nc1ccon1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H23N3O4S/c1-2-3-6-12-23(15-20(24)21-19-11-13-27-22-19)28(25,26)18-10-9-16-7-4-5-8-17(16)14-18/h4-5,7-11,13-14H,2-3,6,12,15H2,1H3,(H,21,22,24) |
| InChIKey | IMHHLHSQWPWVRH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|