C30H46N2O5S — CID 101015981
6-[butyl(naphthalen-2-ylsulfonyl)amino]-2-(decanoylamino)hexanoic acid (PubChem CID 101015981) has the molecular formula C30H46N2O5S and a molecular weight of 546.77 g/mol. Its IUPAC name is 6-[butyl(naphthalen-2-ylsulfonyl)amino]-2-(decanoylamino)hexanoic acid.
| Compound Name | 6-[butyl(naphthalen-2-ylsulfonyl)amino]-2-(decanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 101015981 |
| Molecular Formula | C30H46N2O5S |
| Molecular Weight | 546.77 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | 6-[butyl(naphthalen-2-ylsulfonyl)amino]-2-(decanoylamino)hexanoic acid |
| SMILES | CCCCCCCCCC(=O)NC(CCCCN(CCCC)S(=O)(=O)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C30H46N2O5S/c1-3-5-7-8-9-10-11-19-29(33)31-28(30(34)35)18-14-15-23-32(22-6-4-2)38(36,37)27-21-20-25-16-12-13-17-26(25)24-27/h12-13,16-17,20-21,24,28H,3-11,14-15,18-19,22-23H2,1-2H3,(H,31,33)(H,34,35) |
| InChIKey | JZSIUTICPDAVPA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.77 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|