C26H42N2O6S — CID 101015975
2-(decanoylamino)-6-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]hexanoic acid (PubChem CID 101015975) has the molecular formula C26H42N2O6S and a molecular weight of 510.70 g/mol. Its IUPAC name is 2-(decanoylamino)-6-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]hexanoic acid.
| Compound Name | 2-(decanoylamino)-6-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]hexanoic acid |
|---|---|
| PubChem CID | 101015975 |
| Molecular Formula | C26H42N2O6S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 2-(decanoylamino)-6-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]hexanoic acid |
| SMILES | C=CCN(CCCCC(NC(=O)CCCCCCCCC)C(=O)O)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H42N2O6S/c1-4-6-7-8-9-10-11-15-25(29)27-24(26(30)31)14-12-13-21-28(20-5-2)35(32,33)23-18-16-22(34-3)17-19-23/h5,16-19,24H,2,4,6-15,20-21H2,1,3H3,(H,27,29)(H,30,31) |
| InChIKey | OQZVESRUPUUKPW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|