C23H44N2O5S — CID 101015983
6-[butylsulfonyl(prop-2-enyl)amino]-2-(decanoylamino)hexanoic acid (PubChem CID 101015983) has the molecular formula C23H44N2O5S and a molecular weight of 460.68 g/mol. Its IUPAC name is 6-[butylsulfonyl(prop-2-enyl)amino]-2-(decanoylamino)hexanoic acid.
| Compound Name | 6-[butylsulfonyl(prop-2-enyl)amino]-2-(decanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 101015983 |
| Molecular Formula | C23H44N2O5S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 6-[butylsulfonyl(prop-2-enyl)amino]-2-(decanoylamino)hexanoic acid |
| SMILES | C=CCN(CCCCC(NC(=O)CCCCCCCCC)C(=O)O)S(=O)(=O)CCCC |
| InChI | InChI=1S/C23H44N2O5S/c1-4-7-9-10-11-12-13-17-22(26)24-21(23(27)28)16-14-15-19-25(18-6-3)31(29,30)20-8-5-2/h6,21H,3-5,7-20H2,1-2H3,(H,24,26)(H,27,28) |
| InChIKey | QDYOIGHSAMGQPA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|