C35H47N3O6 — CID 101014983
6-[benzyl-[2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carbonyl]amino]-2-(decanoylamino)hexanoic acid (PubChem CID 101014983) has the molecular formula C35H47N3O6 and a molecular weight of 605.78 g/mol. Its IUPAC name is 6-[benzyl-[2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carbonyl]amino]-2-(decanoylamino)hexanoic acid.
| Compound Name | 6-[benzyl-[2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carbonyl]amino]-2-(decanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 101014983 |
| Molecular Formula | C35H47N3O6 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.35 |
| IUPAC Name | 6-[benzyl-[2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carbonyl]amino]-2-(decanoylamino)hexanoic acid |
| SMILES | CCCCCCCCCC(=O)NC(CCCCN(Cc1ccccc1)C(=O)c1nc(-c2ccc(OC)cc2)oc1C)C(=O)O |
| InChI | InChI=1S/C35H47N3O6/c1-4-5-6-7-8-9-13-19-31(39)36-30(35(41)42)18-14-15-24-38(25-27-16-11-10-12-17-27)34(40)32-26(2)44-33(37-32)28-20-22-29(43-3)23-21-28/h10-12,16-17,20-23,30H,4-9,13-15,18-19,24-25H2,1-3H3,(H,36,39)(H,41,42) |
| InChIKey | ACNDGSUOAXSVIP-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|