C29H43N3O5 — CID 101014987
2-(decanoylamino)-6-[[5-methyl-2-(2-phenylethyl)-1,3-oxazole-4-carbonyl]amino]hexanoic acid (PubChem CID 101014987) has the molecular formula C29H43N3O5 and a molecular weight of 513.68 g/mol. Its IUPAC name is 2-(decanoylamino)-6-[[5-methyl-2-(2-phenylethyl)-1,3-oxazole-4-carbonyl]amino]hexanoic acid.
| Compound Name | 2-(decanoylamino)-6-[[5-methyl-2-(2-phenylethyl)-1,3-oxazole-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 101014987 |
| Molecular Formula | C29H43N3O5 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | 2-(decanoylamino)-6-[[5-methyl-2-(2-phenylethyl)-1,3-oxazole-4-carbonyl]amino]hexanoic acid |
| SMILES | CCCCCCCCCC(=O)NC(CCCCNC(=O)c1nc(CCc2ccccc2)oc1C)C(=O)O |
| InChI | InChI=1S/C29H43N3O5/c1-3-4-5-6-7-8-12-18-25(33)31-24(29(35)36)17-13-14-21-30-28(34)27-22(2)37-26(32-27)20-19-23-15-10-9-11-16-23/h9-11,15-16,24H,3-8,12-14,17-21H2,1-2H3,(H,30,34)(H,31,33)(H,35,36) |
| InChIKey | MLRAVSFTSPWESA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|