C19H30N2O5S — CID 101015973
6-(butylsulfonylamino)-2-(3-phenylpropanoylamino)hexanoic acid (PubChem CID 101015973) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is 6-(butylsulfonylamino)-2-(3-phenylpropanoylamino)hexanoic acid.
| Compound Name | 6-(butylsulfonylamino)-2-(3-phenylpropanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 101015973 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 6-(butylsulfonylamino)-2-(3-phenylpropanoylamino)hexanoic acid |
| SMILES | CCCCS(=O)(=O)NCCCCC(NC(=O)CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H30N2O5S/c1-2-3-15-27(25,26)20-14-8-7-11-17(19(23)24)21-18(22)13-12-16-9-5-4-6-10-16/h4-6,9-10,17,20H,2-3,7-8,11-15H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | VHIAWLHPIXUYFU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|