C15H22N4O3 — CID 142026144
5-(diaminomethylideneamino)-2-(3-phenylpropanoylamino)pentanoic acid (PubChem CID 142026144) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-(3-phenylpropanoylamino)pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-(3-phenylpropanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 142026144 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-(3-phenylpropanoylamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H22N4O3/c16-15(17)18-10-4-7-12(14(21)22)19-13(20)9-8-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,19,20)(H,21,22)(H4,16,17,18) |
| InChIKey | JOBOHKGJZQOBLW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|