C18H27ClN6O6 — CID 52993950
(2S)-5-(diaminomethylideneamino)-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]pentanoic acid;hydrochloride (PubChem CID 52993950) has the molecular formula C18H27ClN6O6 and a molecular weight of 458.90 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]pentanoic acid;hydrochloride.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 52993950 |
| Molecular Formula | C18H27ClN6O6 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]pentanoic acid;hydrochloride |
| SMILES | Cl.NC(N)=NCCC[C@H](NC(=O)CNC(=O)CNC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H26N6O6.ClH/c19-17(20)21-8-4-7-13(16(27)28)24-15(26)10-22-14(25)9-23-18(29)30-11-12-5-2-1-3-6-12;/h1-3,5-6,13H,4,7-11H2,(H,22,25)(H,23,29)(H,24,26)(H,27,28)(H4,19,20,21);1H/t13-;/m0./s1 |
| InChIKey | CBFOWKONQXLRCU-ZOWNYOTGSA-N |
| XLogP | -0.93 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|