C19H29N5O5 — CID 134256760
5-(diaminomethylideneamino)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]pentanoic acid (PubChem CID 134256760) has the molecular formula C19H29N5O5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 134256760 |
| Molecular Formula | C19H29N5O5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]pentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H29N5O5/c1-12(2)15(24-19(28)29-11-13-7-4-3-5-8-13)16(25)23-14(17(26)27)9-6-10-22-18(20)21/h3-5,7-8,12,14-15H,6,9-11H2,1-2H3,(H,23,25)(H,24,28)(H,26,27)(H4,20,21,22)/t14?,15-/m0/s1 |
| InChIKey | UCVZWDZXBSLWNE-LOACHALJSA-N |
| XLogP | 0.56 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|