C26H32N6O4S — CID 46882063
benzyl N-[1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 46882063) has the molecular formula C26H32N6O4S and a molecular weight of 524.65 g/mol. Its IUPAC name is benzyl N-[1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 46882063 |
| Molecular Formula | C26H32N6O4S |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | benzyl N-[1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H32N6O4S/c1-16(2)21(32-26(35)36-15-17-9-4-3-5-10-17)23(34)30-19(12-8-14-29-25(27)28)22(33)24-31-18-11-6-7-13-20(18)37-24/h3-7,9-11,13,16,19,21H,8,12,14-15H2,1-2H3,(H,30,34)(H,32,35)(H4,27,28,29)/t19-,21?/m0/s1 |
| InChIKey | MJNLRXMOZWFUEW-ZQRQZVKFSA-N |
| XLogP | 2.97 |
| TPSA | 161.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|