C16H21AcN6O2S- — CID 22888589
actinium;[2-[[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylazanide (PubChem CID 22888589) has the molecular formula C16H21AcN6O2S- and a molecular weight of 588.45 g/mol. Its IUPAC name is actinium;[2-[[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylazanide.
| Compound Name | actinium;[2-[[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylazanide |
|---|---|
| PubChem CID | 22888589 |
| Molecular Formula | C16H21AcN6O2S- |
| Molecular Weight | 588.45 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | actinium;[2-[[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-methylazanide |
| SMILES | C[N-]CC(=O)NC(CCCN=C(N)N)C(=O)c1nc2ccccc2s1.[Ac] |
| InChI | InChI=1S/C16H21N6O2S.Ac/c1-19-9-13(23)21-11(6-4-8-20-16(17)18)14(24)15-22-10-5-2-3-7-12(10)25-15;/h2-3,5,7,11H,4,6,8-9H2,1H3,(H,21,23)(H4,17,18,20);/q-1; |
| InChIKey | JUCOJZGSQPTTCU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 137.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|