C21H28N6O3S — CID 57260545
2-acetamido-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]cyclopentane-1-carboxamide (PubChem CID 57260545) has the molecular formula C21H28N6O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-acetamido-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]cyclopentane-1-carboxamide.
| Compound Name | 2-acetamido-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 57260545 |
| Molecular Formula | C21H28N6O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-acetamido-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]cyclopentane-1-carboxamide |
| SMILES | CC(=O)NC1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H28N6O3S/c1-12(28)25-14-8-4-6-13(14)19(30)26-16(9-5-11-24-21(22)23)18(29)20-27-15-7-2-3-10-17(15)31-20/h2-3,7,10,13-14,16H,4-6,8-9,11H2,1H3,(H,25,28)(H,26,30)(H4,22,23,24) |
| InChIKey | CRFLNIUAIOUXDK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|