C25H30N6O4S2 — CID 22888635
N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 22888635) has the molecular formula C25H30N6O4S2 and a molecular weight of 542.69 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22888635 |
| Molecular Formula | C25H30N6O4S2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)NC(CCCN=C(N)N)C(=O)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C25H30N6O4S2/c1-16-10-12-17(13-11-16)37(34,35)31-15-5-8-20(31)23(33)29-19(7-4-14-28-25(26)27)22(32)24-30-18-6-2-3-9-21(18)36-24/h2-3,6,9-13,19-20H,4-5,7-8,14-15H2,1H3,(H,29,33)(H4,26,27,28) |
| InChIKey | QOEVVCPANWUEBF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 160.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|