C19H26N6O2S — CID 22888620
N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]piperidine-3-carboxamide (PubChem CID 22888620) has the molecular formula C19H26N6O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]piperidine-3-carboxamide.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 22888620 |
| Molecular Formula | C19H26N6O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]piperidine-3-carboxamide |
| SMILES | NC(N)=NCCCC(NC(=O)C1CCCNC1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H26N6O2S/c20-19(21)23-10-4-7-14(24-17(27)12-5-3-9-22-11-12)16(26)18-25-13-6-1-2-8-15(13)28-18/h1-2,6,8,12,14,22H,3-5,7,9-11H2,(H,24,27)(H4,20,21,23) |
| InChIKey | HIEBJEIPAUKNGE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|