C27H32N4O4S — CID 121250154
[(5S)-6-(1,3-benzothiazol-2-yl)-6-oxo-5-[[(3R)-piperidine-3-carbonyl]amino]hexyl]-benzylcarbamic acid (PubChem CID 121250154) has the molecular formula C27H32N4O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is [(5S)-6-(1,3-benzothiazol-2-yl)-6-oxo-5-[[(3R)-piperidine-3-carbonyl]amino]hexyl]-benzylcarbamic acid.
| Compound Name | [(5S)-6-(1,3-benzothiazol-2-yl)-6-oxo-5-[[(3R)-piperidine-3-carbonyl]amino]hexyl]-benzylcarbamic acid |
|---|---|
| PubChem CID | 121250154 |
| Molecular Formula | C27H32N4O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | [(5S)-6-(1,3-benzothiazol-2-yl)-6-oxo-5-[[(3R)-piperidine-3-carbonyl]amino]hexyl]-benzylcarbamic acid |
| SMILES | O=C(N[C@@H](CCCCN(Cc1ccccc1)C(=O)O)C(=O)c1nc2ccccc2s1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C27H32N4O4S/c32-24(26-30-21-12-4-5-14-23(21)36-26)22(29-25(33)20-11-8-15-28-17-20)13-6-7-16-31(27(34)35)18-19-9-2-1-3-10-19/h1-5,9-10,12,14,20,22,28H,6-8,11,13,15-18H2,(H,29,33)(H,34,35)/t20-,22+/m1/s1 |
| InChIKey | SNWJVYRFBMOKNF-IRLDBZIGSA-N |
| XLogP | 4.31 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|