C32H40N4O6S — CID 174987965
tert-butyl (3R)-3-[[1-(1,3-benzothiazol-2-yl)-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 174987965) has the molecular formula C32H40N4O6S and a molecular weight of 608.76 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[1-(1,3-benzothiazol-2-yl)-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[1-(1,3-benzothiazol-2-yl)-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174987965 |
| Molecular Formula | C32H40N4O6S |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | tert-butyl (3R)-3-[[1-(1,3-benzothiazol-2-yl)-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)NC(CCCCNC(=O)OCc2ccccc2)C(=O)c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C32H40N4O6S/c1-32(2,3)42-31(40)36-19-11-14-23(20-36)28(38)34-25(27(37)29-35-24-15-7-8-17-26(24)43-29)16-9-10-18-33-30(39)41-21-22-12-5-4-6-13-22/h4-8,12-13,15,17,23,25H,9-11,14,16,18-21H2,1-3H3,(H,33,39)(H,34,38)/t23-,25?/m1/s1 |
| InChIKey | HKPFQYLJHUXZHJ-XQZUBTRRSA-N |
| XLogP | 5.71 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|