C27H31N3O5S — CID 121250310
benzyl N-[(5S)-6-(1,3-benzothiazol-2-yl)-5-(oxane-4-carbonylamino)-6-oxohexyl]carbamate (PubChem CID 121250310) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is benzyl N-[(5S)-6-(1,3-benzothiazol-2-yl)-5-(oxane-4-carbonylamino)-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-6-(1,3-benzothiazol-2-yl)-5-(oxane-4-carbonylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 121250310 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | benzyl N-[(5S)-6-(1,3-benzothiazol-2-yl)-5-(oxane-4-carbonylamino)-6-oxohexyl]carbamate |
| SMILES | O=C(NCCCC[C@H](NC(=O)C1CCOCC1)C(=O)c1nc2ccccc2s1)OCc1ccccc1 |
| InChI | InChI=1S/C27H31N3O5S/c31-24(26-30-21-10-4-5-12-23(21)36-26)22(29-25(32)20-13-16-34-17-14-20)11-6-7-15-28-27(33)35-18-19-8-2-1-3-9-19/h1-5,8-10,12,20,22H,6-7,11,13-18H2,(H,28,33)(H,29,32)/t22-/m0/s1 |
| InChIKey | IIJNFTJBFSGJHU-QFIPXVFZSA-N |
| XLogP | 4.49 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|