C26H33N3O2S — CID 145061321
N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide;ethane (PubChem CID 145061321) has the molecular formula C26H33N3O2S and a molecular weight of 451.64 g/mol. Its IUPAC name is N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide;ethane.
| Compound Name | N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 145061321 |
| Molecular Formula | C26H33N3O2S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide;ethane |
| SMILES | CC.NCCCCC(NC(=O)C1CCc2ccccc2C1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H27N3O2S.C2H6/c25-14-6-5-10-20(22(28)24-27-19-9-3-4-11-21(19)30-24)26-23(29)18-13-12-16-7-1-2-8-17(16)15-18;1-2/h1-4,7-9,11,18,20H,5-6,10,12-15,25H2,(H,26,29);1-2H3 |
| InChIKey | FXZKWSQJVCIYOW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|