C29H35N3O3S — CID 121262767
(3R)-N-[1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1-(3-phenylpropanoyl)piperidine-3-carboxamide (PubChem CID 121262767) has the molecular formula C29H35N3O3S and a molecular weight of 505.68 g/mol. Its IUPAC name is (3R)-N-[1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1-(3-phenylpropanoyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1-(3-phenylpropanoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121262767 |
| Molecular Formula | C29H35N3O3S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | (3R)-N-[1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1-(3-phenylpropanoyl)piperidine-3-carboxamide |
| SMILES | CCCCCC(NC(=O)[C@@H]1CCCN(C(=O)CCc2ccccc2)C1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C29H35N3O3S/c1-2-3-5-15-24(27(34)29-31-23-14-8-9-16-25(23)36-29)30-28(35)22-13-10-19-32(20-22)26(33)18-17-21-11-6-4-7-12-21/h4,6-9,11-12,14,16,22,24H,2-3,5,10,13,15,17-20H2,1H3,(H,30,35)/t22-,24?/m1/s1 |
| InChIKey | FSUCCZHDKGKXGW-LETIRJCYSA-N |
| XLogP | 5.42 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|