C25H28N2O2S — CID 121262707
N-[1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide (PubChem CID 121262707) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 121262707 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| SMILES | CCCCCC(NC(=O)C1CCCc2ccccc21)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H28N2O2S/c1-2-3-4-15-21(23(28)25-27-20-14-7-8-16-22(20)30-25)26-24(29)19-13-9-11-17-10-5-6-12-18(17)19/h5-8,10,12,14,16,19,21H,2-4,9,11,13,15H2,1H3,(H,26,29) |
| InChIKey | SOAUXPRTWABEQT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|