C22H30N2O3S — CID 121262730
N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1-methoxycyclohexane-1-carboxamide (PubChem CID 121262730) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1-methoxycyclohexane-1-carboxamide.
| Compound Name | N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1-methoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121262730 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | N-[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxoheptan-2-yl]-1-methoxycyclohexane-1-carboxamide |
| SMILES | CCCCC[C@H](NC(=O)C1(OC)CCCCC1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H30N2O3S/c1-3-4-6-12-17(24-21(26)22(27-2)14-9-5-10-15-22)19(25)20-23-16-11-7-8-13-18(16)28-20/h7-8,11,13,17H,3-6,9-10,12,14-15H2,1-2H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | FKGLUKQDIZATDY-KRWDZBQOSA-N |
| XLogP | 4.89 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|