C18H23N3O3S — CID 121280095
(2S)-N-[(2S)-6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]oxolane-2-carboxamide (PubChem CID 121280095) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is (2S)-N-[(2S)-6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 121280095 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (2S)-N-[(2S)-6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]oxolane-2-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CCCO1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H23N3O3S/c19-10-4-3-7-13(20-17(23)14-8-5-11-24-14)16(22)18-21-12-6-1-2-9-15(12)25-18/h1-2,6,9,13-14H,3-5,7-8,10-11,19H2,(H,20,23)/t13-,14-/m0/s1 |
| InChIKey | PEAGDMNORWSPOH-KBPBESRZSA-N |
| XLogP | 2.27 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|