C17H21AcN6O2S- — CID 22888603
actinium;N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-azanidacyclobutane-2-carboxamide (PubChem CID 22888603) has the molecular formula C17H21AcN6O2S- and a molecular weight of 600.46 g/mol. Its IUPAC name is actinium;N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-azanidacyclobutane-2-carboxamide.
| Compound Name | actinium;N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-azanidacyclobutane-2-carboxamide |
|---|---|
| PubChem CID | 22888603 |
| Molecular Formula | C17H21AcN6O2S- |
| Molecular Weight | 600.46 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | actinium;N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-azanidacyclobutane-2-carboxamide |
| SMILES | NC(N)=NCCCC(NC(=O)C1CC[N-]1)C(=O)c1nc2ccccc2s1.[Ac] |
| InChI | InChI=1S/C17H21N6O2S.Ac/c18-17(19)21-8-3-5-11(22-15(25)12-7-9-20-12)14(24)16-23-10-4-1-2-6-13(10)26-16;/h1-2,4,6,11-12H,3,5,7-9H2,(H,22,25)(H4,18,19,21);/q-1; |
| InChIKey | CHSUFTOQTUNWMN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 137.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|