C17H22N6O3S — CID 22888637
N'-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]butanediamide (PubChem CID 22888637) has the molecular formula C17H22N6O3S and a molecular weight of 390.47 g/mol. Its IUPAC name is N'-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]butanediamide.
| Compound Name | N'-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]butanediamide |
|---|---|
| PubChem CID | 22888637 |
| Molecular Formula | C17H22N6O3S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N'-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]butanediamide |
| SMILES | NC(=O)CCC(=O)NC(CCCN=C(N)N)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H22N6O3S/c18-13(24)7-8-14(25)22-11(5-3-9-21-17(19)20)15(26)16-23-10-4-1-2-6-12(10)27-16/h1-2,4,6,11H,3,5,7-9H2,(H2,18,24)(H,22,25)(H4,19,20,21) |
| InChIKey | NDNCFZLBXVFWKI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 166.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|