C29H37N7O6S2 — CID 159574053
N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-benzyl-5-(methanesulfonamido)-4-oxooctanediamide (PubChem CID 159574053) has the molecular formula C29H37N7O6S2 and a molecular weight of 643.79 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-benzyl-5-(methanesulfonamido)-4-oxooctanediamide.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-benzyl-5-(methanesulfonamido)-4-oxooctanediamide |
|---|---|
| PubChem CID | 159574053 |
| Molecular Formula | C29H37N7O6S2 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.22 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-benzyl-5-(methanesulfonamido)-4-oxooctanediamide |
| SMILES | CS(=O)(=O)NC(CCC(N)=O)C(=O)CC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C29H37N7O6S2/c1-44(41,42)36-20(13-14-25(30)38)23(37)17-19(16-18-8-3-2-4-9-18)27(40)34-22(11-7-15-33-29(31)32)26(39)28-35-21-10-5-6-12-24(21)43-28/h2-6,8-10,12,19-20,22,36H,7,11,13-17H2,1H3,(H2,30,38)(H,34,40)(H4,31,32,33) |
| InChIKey | MIEFQSIFRCJDEN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 229.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|