C33H41N5O5S — CID 161479813
(2R,5S)-5-acetamido-N-[(2S)-5-(1-aminopropylideneamino)-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]-2-benzyl-4,8-dioxononanamide (PubChem CID 161479813) has the molecular formula C33H41N5O5S and a molecular weight of 619.79 g/mol. Its IUPAC name is (2R,5S)-5-acetamido-N-[(2S)-5-(1-aminopropylideneamino)-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]-2-benzyl-4,8-dioxononanamide.
| Compound Name | (2R,5S)-5-acetamido-N-[(2S)-5-(1-aminopropylideneamino)-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]-2-benzyl-4,8-dioxononanamide |
|---|---|
| PubChem CID | 161479813 |
| Molecular Formula | C33H41N5O5S |
| Molecular Weight | 619.79 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | (2R,5S)-5-acetamido-N-[(2S)-5-(1-aminopropylideneamino)-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]-2-benzyl-4,8-dioxononanamide |
| SMILES | CC/C(N)=N\CCC[C@H](NC(=O)C(CC(=O)[C@H](CCC(C)=O)NC(C)=O)Cc1ccccc1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C33H41N5O5S/c1-4-30(34)35-18-10-14-27(31(42)33-38-26-13-8-9-15-29(26)44-33)37-32(43)24(19-23-11-6-5-7-12-23)20-28(41)25(36-22(3)40)17-16-21(2)39/h5-9,11-13,15,24-25,27H,4,10,14,16-20H2,1-3H3,(H2,34,35)(H,36,40)(H,37,43)/t24?,25-,27-/m0/s1 |
| InChIKey | RXJFSUONBZBCFG-XICMLOBYSA-N |
| XLogP | 4.20 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|