C19H25N7O4S — CID 166895104
2-acetamido-N-[2-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]acetamide (PubChem CID 166895104) has the molecular formula C19H25N7O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 2-acetamido-N-[2-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]acetamide.
| Compound Name | 2-acetamido-N-[2-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 166895104 |
| Molecular Formula | C19H25N7O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-acetamido-N-[2-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H25N7O4S/c1-11(27)23-9-15(28)24-10-16(29)25-13(6-4-8-22-19(20)21)17(30)18-26-12-5-2-3-7-14(12)31-18/h2-3,5,7,13H,4,6,8-10H2,1H3,(H,23,27)(H,24,28)(H,25,29)(H4,20,21,22)/t13-/m0/s1 |
| InChIKey | BGNOOPUWXILZRE-ZDUSSCGKSA-N |
| XLogP | -0.73 |
| TPSA | 181.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|