C27H34N6O6S2 — CID 11039306
2-acetamido-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]acetamide (PubChem CID 11039306) has the molecular formula C27H34N6O6S2 and a molecular weight of 602.74 g/mol. Its IUPAC name is 2-acetamido-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]acetamide.
| Compound Name | 2-acetamido-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 11039306 |
| Molecular Formula | C27H34N6O6S2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 2-acetamido-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]acetamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)CNC(C)=O)C(=O)c2nc3ccccc3s2)c(C)c1C |
| InChI | InChI=1S/C27H34N6O6S2/c1-15-13-21(39-5)16(2)17(3)25(15)41(37,38)33-27(28)29-12-8-10-20(31-23(35)14-30-18(4)34)24(36)26-32-19-9-6-7-11-22(19)40-26/h6-7,9,11,13,20H,8,10,12,14H2,1-5H3,(H,30,34)(H,31,35)(H3,28,29,33)/t20-/m0/s1 |
| InChIKey | AGFFLFKSHHUKAZ-FQEVSTJZSA-N |
| XLogP | 2.11 |
| TPSA | 181.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|