C30H40N6O6S2 — CID 10963303
(2S)-1-acetyl-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 10963303) has the molecular formula C30H40N6O6S2 and a molecular weight of 644.82 g/mol. Its IUPAC name is (2S)-1-acetyl-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-acetyl-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10963303 |
| Molecular Formula | C30H40N6O6S2 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | (2S)-1-acetyl-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)[C@@H]2CCCN2C(C)=O)C(O)c2nc3ccccc3s2)c(C)c1C |
| InChI | InChI=1S/C30H40N6O6S2/c1-17-16-24(42-5)18(2)19(3)27(17)44(40,41)35-30(31)32-14-8-11-22(33-28(39)23-12-9-15-36(23)20(4)37)26(38)29-34-21-10-6-7-13-25(21)43-29/h6-7,10,13,16,22-23,26,38H,8-9,11-12,14-15H2,1-5H3,(H,33,39)(H3,31,32,35)/t22-,23-,26?/m0/s1 |
| InChIKey | QBUNDRYGRIYRBB-XAWUTYGVSA-N |
| XLogP | 2.83 |
| TPSA | 176.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|