C29H37N7O5S2 — CID 11072247
(2S)-2-amino-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-hydroxy-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-(4-cyanophenyl)propanamide (PubChem CID 11072247) has the molecular formula C29H37N7O5S2 and a molecular weight of 627.79 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-hydroxy-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-(4-cyanophenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-hydroxy-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-(4-cyanophenyl)propanamide |
|---|---|
| PubChem CID | 11072247 |
| Molecular Formula | C29H37N7O5S2 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.23 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-hydroxy-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-(4-cyanophenyl)propanamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)[C@@H](N)Cc2ccc(C#N)cc2)C(O)c2nccs2)c(C)c1C |
| InChI | InChI=1S/C29H37N7O5S2/c1-17-14-24(41-4)18(2)19(3)26(17)43(39,40)36-29(32)34-11-5-6-23(25(37)28-33-12-13-42-28)35-27(38)22(31)15-20-7-9-21(16-30)10-8-20/h7-10,12-14,22-23,25,37H,5-6,11,15,31H2,1-4H3,(H,35,38)(H3,32,34,36)/t22-,23-,25?/m0/s1 |
| InChIKey | RFPWDOMNPRRSDX-REQUTJCGSA-N |
| XLogP | 2.11 |
| TPSA | 205.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|