C19H27N5O4S2 — CID 15908136
2-[(4R)-4-amino-5-oxo-5-(1,3-thiazol-2-yl)pentyl]-1-(4-methoxy-2,3,6-trimethylphenyl)sulfonylguanidine (PubChem CID 15908136) has the molecular formula C19H27N5O4S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-[(4R)-4-amino-5-oxo-5-(1,3-thiazol-2-yl)pentyl]-1-(4-methoxy-2,3,6-trimethylphenyl)sulfonylguanidine.
| Compound Name | 2-[(4R)-4-amino-5-oxo-5-(1,3-thiazol-2-yl)pentyl]-1-(4-methoxy-2,3,6-trimethylphenyl)sulfonylguanidine |
|---|---|
| PubChem CID | 15908136 |
| Molecular Formula | C19H27N5O4S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[(4R)-4-amino-5-oxo-5-(1,3-thiazol-2-yl)pentyl]-1-(4-methoxy-2,3,6-trimethylphenyl)sulfonylguanidine |
| SMILES | COc1cc(C)c(S(=O)(=O)N/C(N)=N/CCC[C@@H](N)C(=O)c2nccs2)c(C)c1C |
| InChI | InChI=1S/C19H27N5O4S2/c1-11-10-15(28-4)12(2)13(3)17(11)30(26,27)24-19(21)23-7-5-6-14(20)16(25)18-22-8-9-29-18/h8-10,14H,5-7,20H2,1-4H3,(H3,21,23,24)/t14-/m1/s1 |
| InChIKey | WMABLHCESVMCJK-CQSZACIVSA-N |
| XLogP | 1.66 |
| TPSA | 149.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|