C32H40N6O5S2 — CID 11734957
(2S)-2-amino-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-hydroxy-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-naphthalen-2-ylpropanamide (PubChem CID 11734957) has the molecular formula C32H40N6O5S2 and a molecular weight of 652.84 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-hydroxy-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-naphthalen-2-ylpropanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-hydroxy-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 11734957 |
| Molecular Formula | C32H40N6O5S2 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-hydroxy-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-naphthalen-2-ylpropanamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)[C@@H](N)Cc2ccc3ccccc3c2)C(O)c2nccs2)c(C)c1C |
| InChI | InChI=1S/C32H40N6O5S2/c1-19-16-27(43-4)20(2)21(3)29(19)45(41,42)38-32(34)36-13-7-10-26(28(39)31-35-14-15-44-31)37-30(40)25(33)18-22-11-12-23-8-5-6-9-24(23)17-22/h5-6,8-9,11-12,14-17,25-26,28,39H,7,10,13,18,33H2,1-4H3,(H,37,40)(H3,34,36,38)/t25-,26-,28?/m0/s1 |
| InChIKey | CSUFYMPMOMTWBS-QIELNMHASA-N |
| XLogP | 3.39 |
| TPSA | 182.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|