C28H39N5O6S2 — CID 57363058
[(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]-tert-butylcarbamic acid (PubChem CID 57363058) has the molecular formula C28H39N5O6S2 and a molecular weight of 605.78 g/mol. Its IUPAC name is [(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 57363058 |
| Molecular Formula | C28H39N5O6S2 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | [(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]-tert-butylcarbamic acid |
| SMILES | COc1cc(C)c(S(=O)(=O)N/C(N)=N/CCC[C@@H](C(O)c2nc3ccccc3s2)N(C(=O)O)C(C)(C)C)c(C)c1C |
| InChI | InChI=1S/C28H39N5O6S2/c1-16-15-21(39-7)17(2)18(3)24(16)41(37,38)32-26(29)30-14-10-12-20(33(27(35)36)28(4,5)6)23(34)25-31-19-11-8-9-13-22(19)40-25/h8-9,11,13,15,20,23,34H,10,12,14H2,1-7H3,(H,35,36)(H3,29,30,32)/t20-,23?/m0/s1 |
| InChIKey | RJMAQMAAIZPKRM-AJZOCDQUSA-N |
| XLogP | 4.48 |
| TPSA | 167.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|