C24H33N5O2S — CID 59075528
1-[(4S)-4-amino-5-(1,3-benzothiazol-2-yl)-5-hydroxypentyl]-2-[(4-methoxy-2,3,6-trimethylphenyl)methyl]guanidine (PubChem CID 59075528) has the molecular formula C24H33N5O2S and a molecular weight of 455.63 g/mol. Its IUPAC name is 1-[(4S)-4-amino-5-(1,3-benzothiazol-2-yl)-5-hydroxypentyl]-2-[(4-methoxy-2,3,6-trimethylphenyl)methyl]guanidine.
| Compound Name | 1-[(4S)-4-amino-5-(1,3-benzothiazol-2-yl)-5-hydroxypentyl]-2-[(4-methoxy-2,3,6-trimethylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 59075528 |
| Molecular Formula | C24H33N5O2S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 1-[(4S)-4-amino-5-(1,3-benzothiazol-2-yl)-5-hydroxypentyl]-2-[(4-methoxy-2,3,6-trimethylphenyl)methyl]guanidine |
| SMILES | COc1cc(C)c(C/N=C(\N)NCCC[C@H](N)C(O)c2nc3ccccc3s2)c(C)c1C |
| InChI | InChI=1S/C24H33N5O2S/c1-14-12-20(31-4)16(3)15(2)17(14)13-28-24(26)27-11-7-8-18(25)22(30)23-29-19-9-5-6-10-21(19)32-23/h5-6,9-10,12,18,22,30H,7-8,11,13,25H2,1-4H3,(H3,26,27,28)/t18-,22?/m0/s1 |
| InChIKey | WYUUGAZJWAWZBO-HXBUSHRASA-N |
| XLogP | 3.48 |
| TPSA | 118.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|