C16H16N2OS — CID 43314632
1-(1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)ethanamine (PubChem CID 43314632) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)ethanamine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 43314632 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)ethanamine |
| SMILES | COc1ccccc1CC(N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H16N2OS/c1-19-14-8-4-2-6-11(14)10-12(17)16-18-13-7-3-5-9-15(13)20-16/h2-9,12H,10,17H2,1H3 |
| InChIKey | OAKCQXVVHQAGPJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |