C19H18N2S — CID 168913459
1-(1,3-benzothiazol-2-yl)-2-(3-but-1-ynylphenyl)ethanamine (PubChem CID 168913459) has the molecular formula C19H18N2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-2-(3-but-1-ynylphenyl)ethanamine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-2-(3-but-1-ynylphenyl)ethanamine |
|---|---|
| PubChem CID | 168913459 |
| Molecular Formula | C19H18N2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-2-(3-but-1-ynylphenyl)ethanamine |
| SMILES | CCC#Cc1cccc(CC(N)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H18N2S/c1-2-3-7-14-8-6-9-15(12-14)13-16(20)19-21-17-10-4-5-11-18(17)22-19/h4-6,8-12,16H,2,13,20H2,1H3 |
| InChIKey | BLDNXCYJTMTPHR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|