C24H28N2O2S — CID 168913276
N-[1-(1,3-benzothiazol-2-yl)-2-(3-prop-1-ynylphenyl)ethyl]formamide;2-methoxy-2-methylpropane (PubChem CID 168913276) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)-2-(3-prop-1-ynylphenyl)ethyl]formamide;2-methoxy-2-methylpropane.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)-2-(3-prop-1-ynylphenyl)ethyl]formamide;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 168913276 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)-2-(3-prop-1-ynylphenyl)ethyl]formamide;2-methoxy-2-methylpropane |
| SMILES | CC#Cc1cccc(CC(NC=O)c2nc3ccccc3s2)c1.COC(C)(C)C |
| InChI | InChI=1S/C19H16N2OS.C5H12O/c1-2-6-14-7-5-8-15(11-14)12-17(20-13-22)19-21-16-9-3-4-10-18(16)23-19;1-5(2,3)6-4/h3-5,7-11,13,17H,12H2,1H3,(H,20,22);1-4H3 |
| InChIKey | JSRCDOUHOMHELM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|