C26H33N3S2 — CID 168913396
3-[[1-(1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylaniline;ethane (PubChem CID 168913396) has the molecular formula C26H33N3S2 and a molecular weight of 451.71 g/mol. Its IUPAC name is 3-[[1-(1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylaniline;ethane.
| Compound Name | 3-[[1-(1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylaniline;ethane |
|---|---|
| PubChem CID | 168913396 |
| Molecular Formula | C26H33N3S2 |
| Molecular Weight | 451.71 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3-[[1-(1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylaniline;ethane |
| SMILES | CC.CC.Cc1cccc(CC(NSc2cccc(N)c2)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C22H21N3S2.2C2H6/c1-15-6-4-7-16(12-15)13-20(25-27-18-9-5-8-17(23)14-18)22-24-19-10-2-3-11-21(19)26-22;2*1-2/h2-12,14,20,25H,13,23H2,1H3;2*1-2H3 |
| InChIKey | BZMKVIQHHYBOBQ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.71 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|