C26H26N8OS2 — CID 168913539
(2E)-N-[3-[[(1S)-1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]sulfanylphenyl]-2-hydrazinylidene-3-methyliminopropanamide (PubChem CID 168913539) has the molecular formula C26H26N8OS2 and a molecular weight of 530.68 g/mol. Its IUPAC name is (2E)-N-[3-[[(1S)-1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]sulfanylphenyl]-2-hydrazinylidene-3-methyliminopropanamide.
| Compound Name | (2E)-N-[3-[[(1S)-1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]sulfanylphenyl]-2-hydrazinylidene-3-methyliminopropanamide |
|---|---|
| PubChem CID | 168913539 |
| Molecular Formula | C26H26N8OS2 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (2E)-N-[3-[[(1S)-1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]sulfanylphenyl]-2-hydrazinylidene-3-methyliminopropanamide |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NSc2cccc(NC(=O)C(/C=N/C)=N/N)c2)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C26H26N8OS2/c1-30-15-22(33-29)25(35)31-18-8-5-9-19(14-18)37-34-21(13-16-6-4-7-17(12-16)24(27)28)26-32-20-10-2-3-11-23(20)36-26/h2-12,14-15,21,34H,13,29H2,1H3,(H3,27,28)(H,31,35)/b30-15+,33-22+/t21-/m0/s1 |
| InChIKey | OQDLSLIZZDMHJI-QTNAZZLCSA-N |
| XLogP | 4.11 |
| TPSA | 154.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|