C25H25N5OS2 — CID 168913624
3-[[1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]sulfanyl-N-ethylbenzamide (PubChem CID 168913624) has the molecular formula C25H25N5OS2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 3-[[1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]sulfanyl-N-ethylbenzamide.
| Compound Name | 3-[[1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]sulfanyl-N-ethylbenzamide |
|---|---|
| PubChem CID | 168913624 |
| Molecular Formula | C25H25N5OS2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 3-[[1-(1,3-benzothiazol-2-yl)-2-(3-carbamimidoylphenyl)ethyl]amino]sulfanyl-N-ethylbenzamide |
| SMILES | [H]/N=C(\N)c1cccc(CC(NSc2cccc(C(=O)NCC)c2)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C25H25N5OS2/c1-2-28-24(31)18-9-6-10-19(15-18)33-30-21(14-16-7-5-8-17(13-16)23(26)27)25-29-20-11-3-4-12-22(20)32-25/h3-13,15,21,30H,2,14H2,1H3,(H3,26,27)(H,28,31) |
| InChIKey | FAKMABIFHXNTCA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|