C25H34N6O2S2 — CID 168913526
N-(2-aminoethyl)-3-[[[2-(3-carbamimidoylphenyl)-1-(1,3-thiazol-2-yl)ethyl]amino]-methylidene-oxo-λ6-sulfanyl]benzamide;propane (PubChem CID 168913526) has the molecular formula C25H34N6O2S2 and a molecular weight of 514.72 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-[[[2-(3-carbamimidoylphenyl)-1-(1,3-thiazol-2-yl)ethyl]amino]-methylidene-oxo-λ6-sulfanyl]benzamide;propane.
| Compound Name | N-(2-aminoethyl)-3-[[[2-(3-carbamimidoylphenyl)-1-(1,3-thiazol-2-yl)ethyl]amino]-methylidene-oxo-λ6-sulfanyl]benzamide;propane |
|---|---|
| PubChem CID | 168913526 |
| Molecular Formula | C25H34N6O2S2 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | N-(2-aminoethyl)-3-[[[2-(3-carbamimidoylphenyl)-1-(1,3-thiazol-2-yl)ethyl]amino]-methylidene-oxo-λ6-sulfanyl]benzamide;propane |
| SMILES | CCC.[H]/N=C(\N)c1cccc(CC(NS(=C)(=O)c2cccc(C(=O)NCCN)c2)c2nccs2)c1 |
| InChI | InChI=1S/C22H26N6O2S2.C3H8/c1-32(30,18-7-3-6-17(14-18)21(29)26-9-8-23)28-19(22-27-10-11-31-22)13-15-4-2-5-16(12-15)20(24)25;1-3-2/h2-7,10-12,14,19H,1,8-9,13,23H2,(H3,24,25)(H,26,29)(H,28,30);3H2,1-2H3 |
| InChIKey | IWUCPQHNQRPUBV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 146.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|